C16H22N2O5 — CID 59855878
(2S)-3-[(4-methylbenzoyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 59855878) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2S)-3-[(4-methylbenzoyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[(4-methylbenzoyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 59855878 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2S)-3-[(4-methylbenzoyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | Cc1ccc(C(=O)NC[C@H](NC(=O)OC(C)(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-10-5-7-11(8-6-10)13(19)17-9-12(14(20)21)18-15(22)23-16(2,3)4/h5-8,12H,9H2,1-4H3,(H,17,19)(H,18,22)(H,20,21)/t12-/m0/s1 |
| InChIKey | XDIIBMLBDLKQPZ-LBPRGKRZSA-N |
| XLogP | 1.70 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |