C30H29F5N4O2S — CID 59856159
N-[(4-methoxyphenyl)methyl]-5-[5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-4-(2-phenylethyl)-1,2,4-triazol-3-yl]pentanamide (PubChem CID 59856159) has the molecular formula C30H29F5N4O2S and a molecular weight of 604.65 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-5-[5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-4-(2-phenylethyl)-1,2,4-triazol-3-yl]pentanamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-5-[5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-4-(2-phenylethyl)-1,2,4-triazol-3-yl]pentanamide |
|---|---|
| PubChem CID | 59856159 |
| Molecular Formula | C30H29F5N4O2S |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-5-[5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-4-(2-phenylethyl)-1,2,4-triazol-3-yl]pentanamide |
| SMILES | COc1ccc(CNC(=O)CCCCc2nnc(SCc3c(F)c(F)c(F)c(F)c3F)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29F5N4O2S/c1-41-21-13-11-20(12-14-21)17-36-24(40)10-6-5-9-23-37-38-30(39(23)16-15-19-7-3-2-4-8-19)42-18-22-25(31)27(33)29(35)28(34)26(22)32/h2-4,7-8,11-14H,5-6,9-10,15-18H2,1H3,(H,36,40) |
| InChIKey | QFLYDGFJWVQHGR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|