C16H8F3IrN2O- — CID 59858933
1-(3H-dibenzofuran-3-id-4-yl)-3-(trifluoromethyl)pyrazole;iridium (PubChem CID 59858933) has the molecular formula C16H8F3IrN2O- and a molecular weight of 493.46 g/mol. Its IUPAC name is 1-(3H-dibenzofuran-3-id-4-yl)-3-(trifluoromethyl)pyrazole;iridium.
| Compound Name | 1-(3H-dibenzofuran-3-id-4-yl)-3-(trifluoromethyl)pyrazole;iridium |
|---|---|
| PubChem CID | 59858933 |
| Molecular Formula | C16H8F3IrN2O- |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | 1-(3H-dibenzofuran-3-id-4-yl)-3-(trifluoromethyl)pyrazole;iridium |
| SMILES | FC(F)(F)c1ccn(-c2[c-]ccc3c2oc2ccccc23)n1.[Ir] |
| InChI | InChI=1S/C16H8F3N2O.Ir/c17-16(18,19)14-8-9-21(20-14)12-6-3-5-11-10-4-1-2-7-13(10)22-15(11)12;/h1-5,7-9H;/q-1; |
| InChIKey | KADPZJHKZBVWJV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|