C28H16F9IrN2O2- — CID 59859317
iridium;2-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]-5-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid (PubChem CID 59859317) has the molecular formula C28H16F9IrN2O2- and a molecular weight of 775.65 g/mol. Its IUPAC name is iridium;2-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]-5-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid.
| Compound Name | iridium;2-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]-5-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59859317 |
| Molecular Formula | C28H16F9IrN2O2- |
| Molecular Weight | 775.65 g/mol |
| Exact Mass | 776.07 |
| IUPAC Name | iridium;2-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]-5-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid |
| SMILES | CC1(C(F)(F)F)c2cc(-c3ccc(C(F)(F)F)cn3)[c-]cc2-c2ccc(C(F)(F)F)cc21.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C22H11F9N.C6H5NO2.Ir/c1-19(22(29,30)31)16-8-11(18-7-4-13(10-32-18)21(26,27)28)2-5-14(16)15-6-3-12(9-17(15)19)20(23,24)25;8-6(9)5-3-1-2-4-7-5;/h3-10H,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | GREUZCJOSBZUSE-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.65 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|