C25H14F6IrN- — CID 59859327
iridium;2-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline (PubChem CID 59859327) has the molecular formula C25H14F6IrN- and a molecular weight of 634.60 g/mol. Its IUPAC name is iridium;2-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline.
| Compound Name | iridium;2-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline |
|---|---|
| PubChem CID | 59859327 |
| Molecular Formula | C25H14F6IrN- |
| Molecular Weight | 634.60 g/mol |
| Exact Mass | 635.07 |
| IUPAC Name | iridium;2-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline |
| SMILES | CC1(C(F)(F)F)c2cc(-c3ccc4ccccc4n3)[c-]cc2-c2ccc(C(F)(F)F)cc21.[Ir] |
| InChI | InChI=1S/C25H14F6N.Ir/c1-23(25(29,30)31)19-12-15(22-11-7-14-4-2-3-5-21(14)32-22)6-9-17(19)18-10-8-16(13-20(18)23)24(26,27)28;/h2-5,7-13H,1H3;/q-1; |
| InChIKey | NQSAUOSSPWUEPK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.60 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|