C39H25F3IrN2-2 — CID 59859370
iridium;2-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;3-phenylisoquinoline (PubChem CID 59859370) has the molecular formula C39H25F3IrN2-2 and a molecular weight of 770.85 g/mol. Its IUPAC name is iridium;2-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;3-phenylisoquinoline.
| Compound Name | iridium;2-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;3-phenylisoquinoline |
|---|---|
| PubChem CID | 59859370 |
| Molecular Formula | C39H25F3IrN2-2 |
| Molecular Weight | 770.85 g/mol |
| Exact Mass | 771.16 |
| IUPAC Name | iridium;2-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;3-phenylisoquinoline |
| SMILES | CC1(C(F)(F)F)c2ccccc2-c2c[c-]c(-c3ccc4ccccc4n3)cc21.[Ir].[c-]1ccccc1-c1cc2ccccc2cn1 |
| InChI | InChI=1S/C24H15F3N.C15H10N.Ir/c1-23(24(25,26)27)19-8-4-3-7-17(19)18-12-10-16(14-20(18)23)22-13-11-15-6-2-5-9-21(15)28-22;1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-16-15;/h2-9,11-14H,1H3;1-6,8-11H;/q2*-1; |
| InChIKey | DHFOICLTYPAYFX-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.85 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|