About 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide
3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide (PubChem CID 59860149) has the molecular formula C27H18F2N4O3S
and a molecular weight of 516.53 g/mol. Its IUPAC name is 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide.
Molecular Properties
| Compound Name | 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide |
| PubChem CID | 59860149 |
| Molecular Formula | C27H18F2N4O3S |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccnc3ccc(-c4cncc(NS(=O)(=O)c5ccc(F)cc5F)c4)cc23)c1 |
| InChI | InChI=1S/C27H18F2N4O3S/c28-20-5-7-26(24(29)13-20)37(35,36)33-21-11-19(14-31-15-21)16-4-6-25-23(12-16)22(8-9-32-25)17-2-1-3-18(10-17)27(30)34/h1-15,33H,(H2,30,34) |
| InChIKey | LKRWPKQNOQYBQM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide?
The IUPAC name of 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide (CID 59860149) is 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide.
What is the SMILES notation for 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide?
The canonical SMILES for 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide is NC(=O)c1cccc(-c2ccnc3ccc(-c4cncc(NS(=O)(=O)c5ccc(F)cc5F)c4)cc23)c1.
What is the InChIKey of 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide?
The InChIKey is LKRWPKQNOQYBQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18F2N4O3S/c28-20-5-7-26(24(29)13-20)37(35,36)33-21-11-19(14-31-15-21)16-4-6-25-23(12-16)22(8-9-32-25)17-2-1-3-18(10-17)27(30)34/h1-15,33H,(H2,30,34).
What are the key properties of 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide?
3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide has a molecular weight of 516.53 g/mol, XLogP of 5.14, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide is sourced from PubChem (CID 59860149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).