C27H18F2N4O3S — CID 59860149
3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide (PubChem CID 59860149) has the molecular formula C27H18F2N4O3S and a molecular weight of 516.53 g/mol. Its IUPAC name is 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide.
| Compound Name | 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide |
|---|---|
| PubChem CID | 59860149 |
| Molecular Formula | C27H18F2N4O3S |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 3-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-3-pyridinyl]quinolin-4-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccnc3ccc(-c4cncc(NS(=O)(=O)c5ccc(F)cc5F)c4)cc23)c1 |
| InChI | InChI=1S/C27H18F2N4O3S/c28-20-5-7-26(24(29)13-20)37(35,36)33-21-11-19(14-31-15-21)16-4-6-25-23(12-16)22(8-9-32-25)17-2-1-3-18(10-17)27(30)34/h1-15,33H,(H2,30,34) |
| InChIKey | LKRWPKQNOQYBQM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |