C12H18O5 — CID 59861719
4-O-ethyl 1-O-methyl (Z)-2-(2,2-dimethylpropanoyl)but-2-enedioate (PubChem CID 59861719) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl (Z)-2-(2,2-dimethylpropanoyl)but-2-enedioate.
| Compound Name | 4-O-ethyl 1-O-methyl (Z)-2-(2,2-dimethylpropanoyl)but-2-enedioate |
|---|---|
| PubChem CID | 59861719 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-O-ethyl 1-O-methyl (Z)-2-(2,2-dimethylpropanoyl)but-2-enedioate |
| SMILES | CCOC(=O)/C=C(\C(=O)OC)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H18O5/c1-6-17-9(13)7-8(11(15)16-5)10(14)12(2,3)4/h7H,6H2,1-5H3/b8-7- |
| InChIKey | PWHIFEDUEASZCJ-FPLPWBNLSA-N |
| XLogP | 1.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|