C10H21ClO3P- — CID 59862963
1-[chloromethoxy-[(2-methylpropan-2-yl)oxy]phosphoryl]-2,2-dimethylpropane (PubChem CID 59862963) has the molecular formula C10H21ClO3P- and a molecular weight of 255.70 g/mol. Its IUPAC name is 1-[chloromethoxy-[(2-methylpropan-2-yl)oxy]phosphoryl]-2,2-dimethylpropane.
| Compound Name | 1-[chloromethoxy-[(2-methylpropan-2-yl)oxy]phosphoryl]-2,2-dimethylpropane |
|---|---|
| PubChem CID | 59862963 |
| Molecular Formula | C10H21ClO3P- |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-[chloromethoxy-[(2-methylpropan-2-yl)oxy]phosphoryl]-2,2-dimethylpropane |
| SMILES | CC(C)(C)[CH-]P(=O)(OCCl)OC(C)(C)C |
| InChI | InChI=1S/C10H21ClO3P/c1-9(2,3)7-15(12,13-8-11)14-10(4,5)6/h7H,8H2,1-6H3/q-1 |
| InChIKey | XOMNYITWSWAKSP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|