C10H10N4O2S — CID 59864748
ethyl 2-amino-4-pyrazin-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 59864748) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is ethyl 2-amino-4-pyrazin-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-amino-4-pyrazin-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59864748 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | ethyl 2-amino-4-pyrazin-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N)nc1-c1cnccn1 |
| InChI | InChI=1S/C10H10N4O2S/c1-2-16-9(15)8-7(14-10(11)17-8)6-5-12-3-4-13-6/h3-5H,2H2,1H3,(H2,11,14) |
| InChIKey | CINGWRWVWSPAQP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |