C8H16N2 — CID 59864819
(2S)-4-ethyl-2,3,5-trimethyl-1,2-dihydroimidazole (PubChem CID 59864819) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (2S)-4-ethyl-2,3,5-trimethyl-1,2-dihydroimidazole.
| Compound Name | (2S)-4-ethyl-2,3,5-trimethyl-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 59864819 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (2S)-4-ethyl-2,3,5-trimethyl-1,2-dihydroimidazole |
| SMILES | CCC1=C(C)N[C@H](C)N1C |
| InChI | InChI=1S/C8H16N2/c1-5-8-6(2)9-7(3)10(8)4/h7,9H,5H2,1-4H3/t7-/m0/s1 |
| InChIKey | BLOZHCMYEZBLNV-ZETCQYMHSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |