C12H12F3NS — CID 59865664
6-tert-butyl-5-(trifluoromethyl)thieno[3,2-b]pyridine (PubChem CID 59865664) has the molecular formula C12H12F3NS and a molecular weight of 259.30 g/mol. Its IUPAC name is 6-tert-butyl-5-(trifluoromethyl)thieno[3,2-b]pyridine.
| Compound Name | 6-tert-butyl-5-(trifluoromethyl)thieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 59865664 |
| Molecular Formula | C12H12F3NS |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 6-tert-butyl-5-(trifluoromethyl)thieno[3,2-b]pyridine |
| SMILES | CC(C)(C)c1cc2sccc2nc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NS/c1-11(2,3)7-6-9-8(4-5-17-9)16-10(7)12(13,14)15/h4-6H,1-3H3 |
| InChIKey | IFADKDRLCOIGBP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |