C18H21Cl2FN2O2S — CID 59865846
N-[5-tert-butyl-3-(2-methoxyethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,4-dichloro-5-fluorobenzamide (PubChem CID 59865846) has the molecular formula C18H21Cl2FN2O2S and a molecular weight of 419.35 g/mol. Its IUPAC name is N-[5-tert-butyl-3-(2-methoxyethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-[5-tert-butyl-3-(2-methoxyethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 59865846 |
| Molecular Formula | C18H21Cl2FN2O2S |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-[5-tert-butyl-3-(2-methoxyethyl)-4-methyl-1,3-thiazol-2-ylidene]-2,4-dichloro-5-fluorobenzamide |
| SMILES | COCCn1c(C)c(C(C)(C)C)s/c1=N/C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2FN2O2S/c1-10-15(18(2,3)4)26-17(23(10)6-7-25-5)22-16(24)11-8-14(21)13(20)9-12(11)19/h8-9H,6-7H2,1-5H3/b22-17+ |
| InChIKey | IXVYAJGNYZOSKQ-OQKWZONESA-N |
| XLogP | 4.99 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|