C17H19ClN2OS — CID 59865991
4-chloro-N-[3-(cyclopropylmethyl)-4,5-dimethyl-1,3-thiazol-2-ylidene]-2-methylbenzamide (PubChem CID 59865991) has the molecular formula C17H19ClN2OS and a molecular weight of 334.87 g/mol. Its IUPAC name is 4-chloro-N-[3-(cyclopropylmethyl)-4,5-dimethyl-1,3-thiazol-2-ylidene]-2-methylbenzamide.
| Compound Name | 4-chloro-N-[3-(cyclopropylmethyl)-4,5-dimethyl-1,3-thiazol-2-ylidene]-2-methylbenzamide |
|---|---|
| PubChem CID | 59865991 |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 4-chloro-N-[3-(cyclopropylmethyl)-4,5-dimethyl-1,3-thiazol-2-ylidene]-2-methylbenzamide |
| SMILES | Cc1cc(Cl)ccc1C(=O)/N=c1\sc(C)c(C)n1CC1CC1 |
| InChI | InChI=1S/C17H19ClN2OS/c1-10-8-14(18)6-7-15(10)16(21)19-17-20(9-13-4-5-13)11(2)12(3)22-17/h6-8,13H,4-5,9H2,1-3H3/b19-17- |
| InChIKey | GLPXLICRCZGKIB-ZPHPHTNESA-N |
| XLogP | 4.28 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|