C24H21N3O — CID 59866268
4-(3-methoxy-5-methylpyrazin-2-yl)-N,N-diphenylaniline (PubChem CID 59866268) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-(3-methoxy-5-methylpyrazin-2-yl)-N,N-diphenylaniline.
| Compound Name | 4-(3-methoxy-5-methylpyrazin-2-yl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 59866268 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-(3-methoxy-5-methylpyrazin-2-yl)-N,N-diphenylaniline |
| SMILES | COc1nc(C)cnc1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O/c1-18-17-25-23(24(26-18)28-2)19-13-15-22(16-14-19)27(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-17H,1-2H3 |
| InChIKey | WEDZQBRZRIKAQE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |