C15H14ClN3O2 — CID 59867508
(2S)-1-(4-chloro-6-phenylpyridazin-3-yl)pyrrolidine-2-carboxylic acid (PubChem CID 59867508) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is (2S)-1-(4-chloro-6-phenylpyridazin-3-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(4-chloro-6-phenylpyridazin-3-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59867508 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2S)-1-(4-chloro-6-phenylpyridazin-3-yl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1c1nnc(-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C15H14ClN3O2/c16-11-9-12(10-5-2-1-3-6-10)17-18-14(11)19-8-4-7-13(19)15(20)21/h1-3,5-6,9,13H,4,7-8H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | WZSVBCVDSFBSBK-ZDUSSCGKSA-N |
| XLogP | 2.85 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |