C31H40N5O4+ — CID 59868707
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(1-hydroxypyridin-1-ium-2-yl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 59868707) has the molecular formula C31H40N5O4+ and a molecular weight of 546.69 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(1-hydroxypyridin-1-ium-2-yl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(1-hydroxypyridin-1-ium-2-yl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 59868707 |
| Molecular Formula | C31H40N5O4+ |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(1-hydroxypyridin-1-ium-2-yl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCNc2cccc[n+]2O)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C31H39N5O4/c1-4-33-17-19-34(20-18-33)27-10-7-9-24-25(27)22-35(31(24)37)26(23-13-14-28(39-2)29(21-23)40-3)11-8-15-32-30-12-5-6-16-36(30)38/h5-7,9-10,12-14,16,21,26,38H,4,8,11,15,17-20,22H2,1-3H3/p+1/t26-/m1/s1 |
| InChIKey | TXILITAKFYVMFV-AREMUKBSSA-O |
| XLogP | 3.96 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|