C14H17NS — CID 59872552
4,5-dimethyl-2-(2-phenylpropan-2-yl)-1,3-thiazole (PubChem CID 59872552) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is 4,5-dimethyl-2-(2-phenylpropan-2-yl)-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-(2-phenylpropan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 59872552 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 4,5-dimethyl-2-(2-phenylpropan-2-yl)-1,3-thiazole |
| SMILES | Cc1nc(C(C)(C)c2ccccc2)sc1C |
| InChI | InChI=1S/C14H17NS/c1-10-11(2)16-13(15-10)14(3,4)12-8-6-5-7-9-12/h5-9H,1-4H3 |
| InChIKey | RRDMQBREGANORB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |