C27H23ClN6O2 — CID 59872576
1-(3-chlorophenyl)-4-[[3-[(4-isocyano-3-pyridin-3-yloxyphenyl)methyl]imidazol-4-yl]methyl]piperazin-2-one (PubChem CID 59872576) has the molecular formula C27H23ClN6O2 and a molecular weight of 498.97 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[[3-[(4-isocyano-3-pyridin-3-yloxyphenyl)methyl]imidazol-4-yl]methyl]piperazin-2-one.
| Compound Name | 1-(3-chlorophenyl)-4-[[3-[(4-isocyano-3-pyridin-3-yloxyphenyl)methyl]imidazol-4-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 59872576 |
| Molecular Formula | C27H23ClN6O2 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[[3-[(4-isocyano-3-pyridin-3-yloxyphenyl)methyl]imidazol-4-yl]methyl]piperazin-2-one |
| SMILES | [C-]#[N+]c1ccc(Cn2cncc2CN2CCN(c3cccc(Cl)c3)C(=O)C2)cc1Oc1cccnc1 |
| InChI | InChI=1S/C27H23ClN6O2/c1-29-25-8-7-20(12-26(25)36-24-6-3-9-30-15-24)16-33-19-31-14-23(33)17-32-10-11-34(27(35)18-32)22-5-2-4-21(28)13-22/h2-9,12-15,19H,10-11,16-18H2 |
| InChIKey | IEHYXGYIPZXMRB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|