C23H35N2+ — CID 59872873
1-methyl-2-[(1-methyl-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-1-ium-2-yl)methylidene]-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrole (PubChem CID 59872873) has the molecular formula C23H35N2+ and a molecular weight of 339.55 g/mol. Its IUPAC name is 1-methyl-2-[(1-methyl-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-1-ium-2-yl)methylidene]-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrole.
| Compound Name | 1-methyl-2-[(1-methyl-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-1-ium-2-yl)methylidene]-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrole |
|---|---|
| PubChem CID | 59872873 |
| Molecular Formula | C23H35N2+ |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | 1-methyl-2-[(1-methyl-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-1-ium-2-yl)methylidene]-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrole |
| SMILES | CN1C(=CC2=[N+](C)C3=C(CCCCCC3)C2)CC2=C1CCCCCC2 |
| InChI | InChI=1S/C23H35N2/c1-24-20(15-18-11-7-3-5-9-13-22(18)24)17-21-16-19-12-8-4-6-10-14-23(19)25(21)2/h17H,3-16H2,1-2H3/q+1 |
| InChIKey | LDHXXMGQHLEZEM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|