C29H49N2+ — CID 90768238
ethane;1-methyl-2-[3-(1-methyl-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-1-ium-2-yl)prop-2-enylidene]-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrole (PubChem CID 90768238) has the molecular formula C29H49N2+ and a molecular weight of 425.73 g/mol. Its IUPAC name is ethane;1-methyl-2-[3-(1-methyl-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-1-ium-2-yl)prop-2-enylidene]-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrole.
| Compound Name | ethane;1-methyl-2-[3-(1-methyl-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-1-ium-2-yl)prop-2-enylidene]-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrole |
|---|---|
| PubChem CID | 90768238 |
| Molecular Formula | C29H49N2+ |
| Molecular Weight | 425.73 g/mol |
| Exact Mass | 425.39 |
| IUPAC Name | ethane;1-methyl-2-[3-(1-methyl-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-1-ium-2-yl)prop-2-enylidene]-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrole |
| SMILES | CC.CC.CN1C(=CC=CC2=[N+](C)C3=C(CCCCCC3)C2)CC2=C1CCCCCC2 |
| InChI | InChI=1S/C25H37N2.2C2H6/c1-26-22(18-20-12-7-3-5-9-16-24(20)26)14-11-15-23-19-21-13-8-4-6-10-17-25(21)27(23)2;2*1-2/h11,14-15H,3-10,12-13,16-19H2,1-2H3;2*1-2H3/q+1;; |
| InChIKey | DCMMZKKWFLHFNS-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.73 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|