C14H15N2O2Y- — CID 59873183
3-(2,4-dimethylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;yttrium (PubChem CID 59873183) has the molecular formula C14H15N2O2Y- and a molecular weight of 332.19 g/mol. Its IUPAC name is 3-(2,4-dimethylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;yttrium.
| Compound Name | 3-(2,4-dimethylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;yttrium |
|---|---|
| PubChem CID | 59873183 |
| Molecular Formula | C14H15N2O2Y- |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3-(2,4-dimethylbenzene-5-id-1-yl)-1,6-dimethylpyrimidine-2,4-dione;yttrium |
| SMILES | Cc1[c-]cc(-n2c(=O)cc(C)n(C)c2=O)c(C)c1.[Y] |
| InChI | InChI=1S/C14H15N2O2.Y/c1-9-5-6-12(10(2)7-9)16-13(17)8-11(3)15(4)14(16)18;/h6-8H,1-4H3;/q-1; |
| InChIKey | PVXWJTIVCVJFIX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|