C8H14O3 — CID 59873571
methyl (2S,3R)-2-hydroxy-2,3-dimethylpent-4-enoate (PubChem CID 59873571) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is methyl (2S,3R)-2-hydroxy-2,3-dimethylpent-4-enoate.
| Compound Name | methyl (2S,3R)-2-hydroxy-2,3-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 59873571 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | methyl (2S,3R)-2-hydroxy-2,3-dimethylpent-4-enoate |
| SMILES | C=C[C@@H](C)[C@](C)(O)C(=O)OC |
| InChI | InChI=1S/C8H14O3/c1-5-6(2)8(3,10)7(9)11-4/h5-6,10H,1H2,2-4H3/t6-,8+/m1/s1 |
| InChIKey | QLNCVAYINHOXJR-SVRRBLITSA-N |
| XLogP | 0.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|