C9H14O4 — CID 102490551
methyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate (PubChem CID 102490551) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate.
| Compound Name | methyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 102490551 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
| SMILES | C=C[C@H](C)[C@@](O)(C(C)=O)C(=O)OC |
| InChI | InChI=1S/C9H14O4/c1-5-6(2)9(12,7(3)10)8(11)13-4/h5-6,12H,1H2,2-4H3/t6-,9+/m0/s1 |
| InChIKey | JPHHNJGNDVEBLH-IMTBSYHQSA-N |
| XLogP | 0.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|