C10H13F3O4 — CID 102490553
2,2,2-trifluoroethyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate (PubChem CID 102490553) has the molecular formula C10H13F3O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate.
| Compound Name | 2,2,2-trifluoroethyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 102490553 |
| Molecular Formula | C10H13F3O4 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2,2,2-trifluoroethyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
| SMILES | C=C[C@H](C)[C@@](O)(C(C)=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C10H13F3O4/c1-4-6(2)10(16,7(3)14)8(15)17-5-9(11,12)13/h4,6,16H,1,5H2,2-3H3/t6-,10+/m0/s1 |
| InChIKey | NUCIQTBKBJSGHM-QUBYGPBYSA-N |
| XLogP | 1.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|