C11H18O5 — CID 102490554
2-methoxyethyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate (PubChem CID 102490554) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-methoxyethyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate.
| Compound Name | 2-methoxyethyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 102490554 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-methoxyethyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
| SMILES | C=C[C@H](C)[C@@](O)(C(C)=O)C(=O)OCCOC |
| InChI | InChI=1S/C11H18O5/c1-5-8(2)11(14,9(3)12)10(13)16-7-6-15-4/h5,8,14H,1,6-7H2,2-4H3/t8-,11+/m0/s1 |
| InChIKey | YWXNFMUQWVTEFT-GZMMTYOYSA-N |
| XLogP | 0.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|