C10H12FNO3S — CID 59874431
3-amino-2-(2-fluoro-4-methylphenyl)-3-oxopropane-1-sulfinic acid (PubChem CID 59874431) has the molecular formula C10H12FNO3S and a molecular weight of 245.27 g/mol. Its IUPAC name is 3-amino-2-(2-fluoro-4-methylphenyl)-3-oxopropane-1-sulfinic acid.
| Compound Name | 3-amino-2-(2-fluoro-4-methylphenyl)-3-oxopropane-1-sulfinic acid |
|---|---|
| PubChem CID | 59874431 |
| Molecular Formula | C10H12FNO3S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-amino-2-(2-fluoro-4-methylphenyl)-3-oxopropane-1-sulfinic acid |
| SMILES | Cc1ccc(C(CS(=O)O)C(N)=O)c(F)c1 |
| InChI | InChI=1S/C10H12FNO3S/c1-6-2-3-7(9(11)4-6)8(10(12)13)5-16(14)15/h2-4,8H,5H2,1H3,(H2,12,13)(H,14,15) |
| InChIKey | IYSAOFYKSOPKOJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|