C10H9N3 — CID 598747
2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile (PubChem CID 598747) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 598747 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile |
| SMILES | Cc1cc(C)c(C#N)c(N)c1C#N |
| InChI | InChI=1S/C10H9N3/c1-6-3-7(2)9(5-12)10(13)8(6)4-11/h3H,13H2,1-2H3 |
| InChIKey | MMZNMKQTEGNFOB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|