About 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile
2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile (PubChem CID 598747) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile |
| PubChem CID | 598747 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile |
| SMILES | Cc1cc(C)c(C#N)c(N)c1C#N |
| InChI | InChI=1S/C10H9N3/c1-6-3-7(2)9(5-12)10(13)8(6)4-11/h3H,13H2,1-2H3 |
| InChIKey | MMZNMKQTEGNFOB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile?
The IUPAC name of 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile (CID 598747) is 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile?
The canonical SMILES for 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile is Cc1cc(C)c(C#N)c(N)c1C#N.
What is the InChIKey of 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile?
The InChIKey is MMZNMKQTEGNFOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-6-3-7(2)9(5-12)10(13)8(6)4-11/h3H,13H2,1-2H3.
What are the key properties of 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile?
2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile has a molecular weight of 171.20 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,6-dimethylbenzene-1,3-dicarbonitrile is sourced from PubChem (CID 598747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).