C9H19N3 — CID 59874915
N,N',4-trimethylpiperidine-1-carboximidamide (PubChem CID 59874915) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is N,N',4-trimethylpiperidine-1-carboximidamide.
| Compound Name | N,N',4-trimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 59874915 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | N,N',4-trimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\NC)N1CCC(C)CC1 |
| InChI | InChI=1S/C9H19N3/c1-8-4-6-12(7-5-8)9(10-2)11-3/h8H,4-7H2,1-3H3,(H,10,11) |
| InChIKey | NNOIRDRKBPWBML-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|