About 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one
3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one (PubChem CID 59876761) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one.
Analyze 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one?
The IUPAC name of 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one (CID 59876761) is 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one.
What is the SMILES notation for 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one?
The canonical SMILES for 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one is CC1=C(C)c2nc(=O)c(C)c(C)n2C1.
What is the InChIKey of 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one?
The InChIKey is VDKOAMGLRHIAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-6-5-13-9(4)8(3)11(14)12-10(13)7(6)2/h5H2,1-4H3.
What are the key properties of 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one?
3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one has a molecular weight of 190.25 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,7,8-tetramethyl-6H-pyrrolo[1,2-a]pyrimidin-2-one is sourced from PubChem (CID 59876761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).