C11H19N2O+ — CID 59338933
2,3,5,6-tetramethyl-1-propan-2-ylpyrimidin-1-ium-4-one (PubChem CID 59338933) has the molecular formula C11H19N2O+ and a molecular weight of 195.29 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-1-propan-2-ylpyrimidin-1-ium-4-one.
| Compound Name | 2,3,5,6-tetramethyl-1-propan-2-ylpyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 59338933 |
| Molecular Formula | C11H19N2O+ |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 2,3,5,6-tetramethyl-1-propan-2-ylpyrimidin-1-ium-4-one |
| SMILES | Cc1c(C)[n+](C(C)C)c(C)n(C)c1=O |
| InChI | InChI=1S/C11H19N2O/c1-7(2)13-9(4)8(3)11(14)12(6)10(13)5/h7H,1-6H3/q+1 |
| InChIKey | HDGGUWMTLAKROB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|