About diethyl (Z)-but-2-enedioate;bis(rutherfordium)
diethyl (Z)-but-2-enedioate;bis(rutherfordium) (PubChem CID 59879583) has the molecular formula C8H10O4Rf2-2
and a molecular weight of 704.16 g/mol. Its IUPAC name is diethyl (Z)-but-2-enedioate;bis(rutherfordium).
Molecular Properties
| Compound Name | diethyl (Z)-but-2-enedioate;bis(rutherfordium) |
| PubChem CID | 59879583 |
| Molecular Formula | C8H10O4Rf2-2 |
| Molecular Weight | 704.16 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | diethyl (Z)-but-2-enedioate;bis(rutherfordium) |
| SMILES | [CH2-]COC(=O)/C=C\C(=O)OC[CH2-].[Rf].[Rf] |
| InChI | InChI=1S/C8H10O4.2Rf/c1-3-11-7(9)5-6-8(10)12-4-2;;/h5-6H,1-4H2;;/q-2;;/b6-5-;; |
| InChIKey | GPXGPHSRECDHPL-XNOMRPDFSA-N |
| XLogP | 0.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 704.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (Z)-but-2-enedioate;bis(rutherfordium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (Z)-but-2-enedioate;bis(rutherfordium)?
The IUPAC name of diethyl (Z)-but-2-enedioate;bis(rutherfordium) (CID 59879583) is diethyl (Z)-but-2-enedioate;bis(rutherfordium).
What is the SMILES notation for diethyl (Z)-but-2-enedioate;bis(rutherfordium)?
The canonical SMILES for diethyl (Z)-but-2-enedioate;bis(rutherfordium) is [CH2-]COC(=O)/C=C\C(=O)OC[CH2-].[Rf].[Rf].
What is the InChIKey of diethyl (Z)-but-2-enedioate;bis(rutherfordium)?
The InChIKey is GPXGPHSRECDHPL-XNOMRPDFSA-N. The full InChI is InChI=1S/C8H10O4.2Rf/c1-3-11-7(9)5-6-8(10)12-4-2;;/h5-6H,1-4H2;;/q-2;;/b6-5-;;.
What are the key properties of diethyl (Z)-but-2-enedioate;bis(rutherfordium)?
diethyl (Z)-but-2-enedioate;bis(rutherfordium) has a molecular weight of 704.16 g/mol, XLogP of 0.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (Z)-but-2-enedioate;bis(rutherfordium) is sourced from PubChem (CID 59879583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).