C10H15N — CID 59879718
2-[(Z)-but-1-enyl]-4,5-dimethyl-3H-pyrrole (PubChem CID 59879718) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-[(Z)-but-1-enyl]-4,5-dimethyl-3H-pyrrole.
| Compound Name | 2-[(Z)-but-1-enyl]-4,5-dimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 59879718 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2-[(Z)-but-1-enyl]-4,5-dimethyl-3H-pyrrole |
| SMILES | CC/C=C\C1=NC(C)=C(C)C1 |
| InChI | InChI=1S/C10H15N/c1-4-5-6-10-7-8(2)9(3)11-10/h5-6H,4,7H2,1-3H3/b6-5- |
| InChIKey | FGLCYQYUCAIROR-WAYWQWQTSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |