C18H25N4OY- — CID 59879773
4-methyl-N-[1-(3-methylphenoxy)butan-2-yl]-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium (PubChem CID 59879773) has the molecular formula C18H25N4OY- and a molecular weight of 402.33 g/mol. Its IUPAC name is 4-methyl-N-[1-(3-methylphenoxy)butan-2-yl]-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium.
| Compound Name | 4-methyl-N-[1-(3-methylphenoxy)butan-2-yl]-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium |
|---|---|
| PubChem CID | 59879773 |
| Molecular Formula | C18H25N4OY- |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-methyl-N-[1-(3-methylphenoxy)butan-2-yl]-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium |
| SMILES | CCC(COc1cccc(C)c1)Nc1nc(C)nc([C-](C)C)n1.[Y] |
| InChI | InChI=1S/C18H25N4O.Y/c1-6-15(11-23-16-9-7-8-13(4)10-16)21-18-20-14(5)19-17(22-18)12(2)3;/h7-10,15H,6,11H2,1-5H3,(H,19,20,21,22);/q-1; |
| InChIKey | MEMJDFCPXSRUQH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|