C29H30N3O5 — CID 59880224
CID 59880224 (PubChem CID 59880224) has the molecular formula C29H30N3O5 and a molecular weight of 500.58 g/mol.
| Compound Name | CID 59880224 |
|---|---|
| PubChem CID | 59880224 |
| Molecular Formula | C29H30N3O5 |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | — |
| SMILES | COc1ccccc1CN(CC(CC1=C[N]c2ccccc21)NC(=O)COc1ccc(O)cc1)C(C)=O |
| InChI | InChI=1S/C29H30N3O5/c1-20(33)32(17-21-7-3-6-10-28(21)36-2)18-23(15-22-16-30-27-9-5-4-8-26(22)27)31-29(35)19-37-25-13-11-24(34)12-14-25/h3-14,16,23,34H,15,17-19H2,1-2H3,(H,31,35) |
| InChIKey | XOMJUFGSSWHEJX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |