C30H30N3O6 — CID 59880226
CID 59880226 (PubChem CID 59880226) has the molecular formula C30H30N3O6 and a molecular weight of 528.59 g/mol.
| Compound Name | CID 59880226 |
|---|---|
| PubChem CID | 59880226 |
| Molecular Formula | C30H30N3O6 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | — |
| SMILES | COc1ccccc1CN(CC(CC1=C[N]c2ccccc21)NC(=O)COc1ccc(C(=O)O)cc1)C(C)=O |
| InChI | InChI=1S/C30H30N3O6/c1-20(34)33(17-22-7-3-6-10-28(22)38-2)18-24(15-23-16-31-27-9-5-4-8-26(23)27)32-29(35)19-39-25-13-11-21(12-14-25)30(36)37/h3-14,16,24H,15,17-19H2,1-2H3,(H,32,35)(H,36,37) |
| InChIKey | GVRGZISBDOGNPU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |