C12H21NO3 — CID 59880557
cyclopentyl N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 59880557) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is cyclopentyl N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | cyclopentyl N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59880557 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | cyclopentyl N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)[C@@H](C=O)NC(=O)OC1CCCC1 |
| InChI | InChI=1S/C12H21NO3/c1-12(2,3)10(8-14)13-11(15)16-9-6-4-5-7-9/h8-10H,4-7H2,1-3H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | ZSICTXPQGNBDSY-SNVBAGLBSA-N |
| XLogP | 2.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|