C11H21N2O5P — CID 22811622
1-[[(2S)-2-(cyclopentyloxycarbonylamino)propanoyl]amino]ethylphosphonous acid (PubChem CID 22811622) has the molecular formula C11H21N2O5P and a molecular weight of 292.27 g/mol. Its IUPAC name is 1-[[(2S)-2-(cyclopentyloxycarbonylamino)propanoyl]amino]ethylphosphonous acid.
| Compound Name | 1-[[(2S)-2-(cyclopentyloxycarbonylamino)propanoyl]amino]ethylphosphonous acid |
|---|---|
| PubChem CID | 22811622 |
| Molecular Formula | C11H21N2O5P |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[[(2S)-2-(cyclopentyloxycarbonylamino)propanoyl]amino]ethylphosphonous acid |
| SMILES | CC(NC(=O)[C@H](C)NC(=O)OC1CCCC1)P(O)O |
| InChI | InChI=1S/C11H21N2O5P/c1-7(10(14)13-8(2)19(16)17)12-11(15)18-9-5-3-4-6-9/h7-9,16-17H,3-6H2,1-2H3,(H,12,15)(H,13,14)/t7-,8?/m0/s1 |
| InChIKey | OMHMWNUYGPQWFS-JAMMHHFISA-N |
| XLogP | 0.80 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|