C17H30N2O5 — CID 22444801
cyclohexyl N-[1-[(2-hydroxyoxolan-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 22444801) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is cyclohexyl N-[1-[(2-hydroxyoxolan-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | cyclohexyl N-[1-[(2-hydroxyoxolan-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 22444801 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | cyclohexyl N-[1-[(2-hydroxyoxolan-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC1CCCCC1)C(=O)NC1CCOC1O |
| InChI | InChI=1S/C17H30N2O5/c1-11(2)10-14(15(20)18-13-8-9-23-16(13)21)19-17(22)24-12-6-4-3-5-7-12/h11-14,16,21H,3-10H2,1-2H3,(H,18,20)(H,19,22) |
| InChIKey | BSCNKPCPWGMMDR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |