C17H26N2O5S — CID 139726517
(2S)-2-(benzenesulfonamido)-N-[(3S)-2-hydroxyoxan-3-yl]-4-methylpentanamide (PubChem CID 139726517) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-N-[(3S)-2-hydroxyoxan-3-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-(benzenesulfonamido)-N-[(3S)-2-hydroxyoxan-3-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 139726517 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-N-[(3S)-2-hydroxyoxan-3-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1ccccc1)C(=O)N[C@H]1CCCOC1O |
| InChI | InChI=1S/C17H26N2O5S/c1-12(2)11-15(16(20)18-14-9-6-10-24-17(14)21)19-25(22,23)13-7-4-3-5-8-13/h3-5,7-8,12,14-15,17,19,21H,6,9-11H2,1-2H3,(H,18,20)/t14-,15-,17?/m0/s1 |
| InChIKey | XPNGWWKYUKVHPB-GIIGEWEBSA-N |
| XLogP | 0.99 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |