C20H28N2O6S — CID 158405748
N-[1-(3,4-dioxo-1,5-oxazonan-2-yl)-5-methyl-2-oxohexan-3-yl]benzenesulfonamide (PubChem CID 158405748) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[1-(3,4-dioxo-1,5-oxazonan-2-yl)-5-methyl-2-oxohexan-3-yl]benzenesulfonamide.
| Compound Name | N-[1-(3,4-dioxo-1,5-oxazonan-2-yl)-5-methyl-2-oxohexan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 158405748 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[1-(3,4-dioxo-1,5-oxazonan-2-yl)-5-methyl-2-oxohexan-3-yl]benzenesulfonamide |
| SMILES | CC(C)CC(NS(=O)(=O)c1ccccc1)C(=O)CC1OCCCCNC(=O)C1=O |
| InChI | InChI=1S/C20H28N2O6S/c1-14(2)12-16(22-29(26,27)15-8-4-3-5-9-15)17(23)13-18-19(24)20(25)21-10-6-7-11-28-18/h3-5,8-9,14,16,18,22H,6-7,10-13H2,1-2H3,(H,21,25) |
| InChIKey | GYRAYBNPJCDZRV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|