C23H34N2O6S — CID 160991586
N-[1-(3,4-dioxo-1-oxa-5-azacyclododec-2-yl)-5-methyl-2-oxohexan-3-yl]benzenesulfonamide (PubChem CID 160991586) has the molecular formula C23H34N2O6S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[1-(3,4-dioxo-1-oxa-5-azacyclododec-2-yl)-5-methyl-2-oxohexan-3-yl]benzenesulfonamide.
| Compound Name | N-[1-(3,4-dioxo-1-oxa-5-azacyclododec-2-yl)-5-methyl-2-oxohexan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 160991586 |
| Molecular Formula | C23H34N2O6S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-[1-(3,4-dioxo-1-oxa-5-azacyclododec-2-yl)-5-methyl-2-oxohexan-3-yl]benzenesulfonamide |
| SMILES | CC(C)CC(NS(=O)(=O)c1ccccc1)C(=O)CC1OCCCCCCCNC(=O)C1=O |
| InChI | InChI=1S/C23H34N2O6S/c1-17(2)15-19(25-32(29,30)18-11-7-6-8-12-18)20(26)16-21-22(27)23(28)24-13-9-4-3-5-10-14-31-21/h6-8,11-12,17,19,21,25H,3-5,9-10,13-16H2,1-2H3,(H,24,28) |
| InChIKey | TURVDQDGKJCAPC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|