C17H22N2O6S — CID 148587281
N-[1-(3,4-dioxooxazepan-5-yl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide (PubChem CID 148587281) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[1-(3,4-dioxooxazepan-5-yl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide.
| Compound Name | N-[1-(3,4-dioxooxazepan-5-yl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 148587281 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[1-(3,4-dioxooxazepan-5-yl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)CC1CCONC(=O)C1=O |
| InChI | InChI=1S/C17H22N2O6S/c1-11(2)15(19-26(23,24)13-6-4-3-5-7-13)14(20)10-12-8-9-25-18-17(22)16(12)21/h3-7,11-12,15,19H,8-10H2,1-2H3,(H,18,22) |
| InChIKey | MZYHDQCVFNIDHQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|