C15H19N3O6S — CID 138730114
2-(benzenesulfonamido)-N-(3,4-dioxooxazinan-5-yl)-3-methylbutanamide (PubChem CID 138730114) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(3,4-dioxooxazinan-5-yl)-3-methylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-(3,4-dioxooxazinan-5-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 138730114 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(3,4-dioxooxazinan-5-yl)-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)NC1CONC(=O)C1=O |
| InChI | InChI=1S/C15H19N3O6S/c1-9(2)12(18-25(22,23)10-6-4-3-5-7-10)14(20)16-11-8-24-17-15(21)13(11)19/h3-7,9,11-12,18H,8H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | BEDOEZLLEAMTIH-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|