C17H23N3O6S — CID 138731399
2-(benzenesulfonamido)-N-(3,4-dioxooxazocan-5-yl)-3-methylbutanamide (PubChem CID 138731399) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(3,4-dioxooxazocan-5-yl)-3-methylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-(3,4-dioxooxazocan-5-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 138731399 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(3,4-dioxooxazocan-5-yl)-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)NC1CCCONC(=O)C1=O |
| InChI | InChI=1S/C17H23N3O6S/c1-11(2)14(20-27(24,25)12-7-4-3-5-8-12)16(22)18-13-9-6-10-26-19-17(23)15(13)21/h3-5,7-8,11,13-14,20H,6,9-10H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | MWZQCFUJWRPLIT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|