C22H26N4O5S — CID 138730646
2-(benzenesulfonamido)-N-(7,8-dioxo-6,9,10,11-tetrahydro-5H-pyrido[3,4-d]azonin-6-yl)-3-methylbutanamide (PubChem CID 138730646) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(7,8-dioxo-6,9,10,11-tetrahydro-5H-pyrido[3,4-d]azonin-6-yl)-3-methylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-(7,8-dioxo-6,9,10,11-tetrahydro-5H-pyrido[3,4-d]azonin-6-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 138730646 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(7,8-dioxo-6,9,10,11-tetrahydro-5H-pyrido[3,4-d]azonin-6-yl)-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)NC1Cc2ccncc2CCNC(=O)C1=O |
| InChI | InChI=1S/C22H26N4O5S/c1-14(2)19(26-32(30,31)17-6-4-3-5-7-17)21(28)25-18-12-15-8-10-23-13-16(15)9-11-24-22(29)20(18)27/h3-8,10,13-14,18-19,26H,9,11-12H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | VMRCWAVJGKAYDY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|