C21H26N4O6S — CID 138731105
2-(benzenesulfonamido)-N-(6,7-dioxo-4,5,8,9,10,11-hexahydro-[1,2]oxazolo[5,4-e]azecin-5-yl)-3-methylbutanamide (PubChem CID 138731105) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(6,7-dioxo-4,5,8,9,10,11-hexahydro-[1,2]oxazolo[5,4-e]azecin-5-yl)-3-methylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-(6,7-dioxo-4,5,8,9,10,11-hexahydro-[1,2]oxazolo[5,4-e]azecin-5-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 138731105 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(6,7-dioxo-4,5,8,9,10,11-hexahydro-[1,2]oxazolo[5,4-e]azecin-5-yl)-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)NC1Cc2cnoc2CCCNC(=O)C1=O |
| InChI | InChI=1S/C21H26N4O6S/c1-13(2)18(25-32(29,30)15-7-4-3-5-8-15)20(27)24-16-11-14-12-23-31-17(14)9-6-10-22-21(28)19(16)26/h3-5,7-8,12-13,16,18,25H,6,9-11H2,1-2H3,(H,22,28)(H,24,27) |
| InChIKey | WWLMKGOFLAGNRH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 147.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|