C21H29N3O5S — CID 138730384
2-(benzenesulfonamido)-N-(4,5-dioxo-3-azabicyclo[6.2.1]undecan-6-yl)-3-methylbutanamide (PubChem CID 138730384) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(4,5-dioxo-3-azabicyclo[6.2.1]undecan-6-yl)-3-methylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-(4,5-dioxo-3-azabicyclo[6.2.1]undecan-6-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 138730384 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(4,5-dioxo-3-azabicyclo[6.2.1]undecan-6-yl)-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)NC1CC2CCC(CNC(=O)C1=O)C2 |
| InChI | InChI=1S/C21H29N3O5S/c1-13(2)18(24-30(28,29)16-6-4-3-5-7-16)20(26)23-17-11-14-8-9-15(10-14)12-22-21(27)19(17)25/h3-7,13-15,17-18,24H,8-12H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | NJAXNACRRFYBOH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|