C23H31NO5S — CID 149343510
N-[1-(4,5-dioxo-3-bicyclo[6.2.1]undecanyl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide (PubChem CID 149343510) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is N-[1-(4,5-dioxo-3-bicyclo[6.2.1]undecanyl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide.
| Compound Name | N-[1-(4,5-dioxo-3-bicyclo[6.2.1]undecanyl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 149343510 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-[1-(4,5-dioxo-3-bicyclo[6.2.1]undecanyl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)CC1CC2CCC(CCC(=O)C1=O)C2 |
| InChI | InChI=1S/C23H31NO5S/c1-15(2)22(24-30(28,29)19-6-4-3-5-7-19)21(26)14-18-13-17-9-8-16(12-17)10-11-20(25)23(18)27/h3-7,15-18,22,24H,8-14H2,1-2H3 |
| InChIKey | YEQBFIPCJAVXIM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|