About N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide
N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide (PubChem CID 149043347) has the molecular formula C18H23FN2O5S
and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide |
| PubChem CID | 149043347 |
| Molecular Formula | C18H23FN2O5S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(F)cc1)C(=O)CC1CCCNC(=O)C1=O |
| InChI | InChI=1S/C18H23FN2O5S/c1-11(2)16(21-27(25,26)14-7-5-13(19)6-8-14)15(22)10-12-4-3-9-20-18(24)17(12)23/h5-8,11-12,16,21H,3-4,9-10H2,1-2H3,(H,20,24)/t12?,16-/m0/s1 |
| InChIKey | QIAIVSLVQDUQDP-INSVYWFGSA-N |
| XLogP | 1.18 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide?
The IUPAC name of N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide (CID 149043347) is N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide?
The canonical SMILES for N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide is CC(C)[C@H](NS(=O)(=O)c1ccc(F)cc1)C(=O)CC1CCCNC(=O)C1=O.
What is the InChIKey of N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide?
The InChIKey is QIAIVSLVQDUQDP-INSVYWFGSA-N. The full InChI is InChI=1S/C18H23FN2O5S/c1-11(2)16(21-27(25,26)14-7-5-13(19)6-8-14)15(22)10-12-4-3-9-20-18(24)17(12)23/h5-8,11-12,16,21H,3-4,9-10H2,1-2H3,(H,20,24)/t12?,16-/m0/s1.
What are the key properties of N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide?
N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide has a molecular weight of 398.46 g/mol, XLogP of 1.18, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 149043347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).