C18H23FN2O5S — CID 149043347
N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide (PubChem CID 149043347) has the molecular formula C18H23FN2O5S and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 149043347 |
| Molecular Formula | C18H23FN2O5S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[(3S)-1-(2,3-dioxoazepan-4-yl)-4-methyl-2-oxopentan-3-yl]-4-fluorobenzenesulfonamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(F)cc1)C(=O)CC1CCCNC(=O)C1=O |
| InChI | InChI=1S/C18H23FN2O5S/c1-11(2)16(21-27(25,26)14-7-5-13(19)6-8-14)15(22)10-12-4-3-9-20-18(24)17(12)23/h5-8,11-12,16,21H,3-4,9-10H2,1-2H3,(H,20,24)/t12?,16-/m0/s1 |
| InChIKey | QIAIVSLVQDUQDP-INSVYWFGSA-N |
| XLogP | 1.18 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|